C15H18O9 — CID 118523589
3-[3-(2-carboxyethenyl)-3-[3-(2,3-dihydroxypropoxy)-3-oxoprop-1-enyl]-2-methyloxiran-2-yl]prop-2-enoic acid (PubChem CID 118523589) has the molecular formula C15H18O9 and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-[3-(2-carboxyethenyl)-3-[3-(2,3-dihydroxypropoxy)-3-oxoprop-1-enyl]-2-methyloxiran-2-yl]prop-2-enoic acid.
| Compound Name | 3-[3-(2-carboxyethenyl)-3-[3-(2,3-dihydroxypropoxy)-3-oxoprop-1-enyl]-2-methyloxiran-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118523589 |
| Molecular Formula | C15H18O9 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-[3-(2-carboxyethenyl)-3-[3-(2,3-dihydroxypropoxy)-3-oxoprop-1-enyl]-2-methyloxiran-2-yl]prop-2-enoic acid |
| SMILES | CC1(C=CC(=O)O)OC1(C=CC(=O)O)C=CC(=O)OCC(O)CO |
| InChI | InChI=1S/C15H18O9/c1-14(5-2-11(18)19)15(24-14,6-3-12(20)21)7-4-13(22)23-9-10(17)8-16/h2-7,10,16-17H,8-9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | DBLRMCPZIPPMAA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|