C14H18O7 — CID 174326174
4-(3-hydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid (PubChem CID 174326174) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is 4-(3-hydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid.
| Compound Name | 4-(3-hydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid |
|---|---|
| PubChem CID | 174326174 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-(3-hydroxypropoxycarbonyl)-2,7-dimethylocta-2,4,6-trienedioic acid |
| SMILES | CC(=CC=C(C=C(C)C(=O)O)C(=O)OCCCO)C(=O)O |
| InChI | InChI=1S/C14H18O7/c1-9(12(16)17)4-5-11(8-10(2)13(18)19)14(20)21-7-3-6-15/h4-5,8,15H,3,6-7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | SMFWAHGSUKUQHZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|