C20H32O6 — CID 88516553
4-hexoxycarbonyl-2-methylhepta-2,4-dienoic acid;methyl 2-methylprop-2-enoate (PubChem CID 88516553) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-hexoxycarbonyl-2-methylhepta-2,4-dienoic acid;methyl 2-methylprop-2-enoate.
| Compound Name | 4-hexoxycarbonyl-2-methylhepta-2,4-dienoic acid;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88516553 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-hexoxycarbonyl-2-methylhepta-2,4-dienoic acid;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.CCC=C(C=C(C)C(=O)O)C(=O)OCCCCCC |
| InChI | InChI=1S/C15H24O4.C5H8O2/c1-4-6-7-8-10-19-15(18)13(9-5-2)11-12(3)14(16)17;1-4(2)5(6)7-3/h9,11H,4-8,10H2,1-3H3,(H,16,17);1H2,2-3H3 |
| InChIKey | ZVQLTCMYNWIDQS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|