C27H50O4 — CID 173433253
2-methylprop-2-enoic acid;octadecyl 2-methylbut-2-enoate (PubChem CID 173433253) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;octadecyl 2-methylbut-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;octadecyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 173433253 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 2-methylprop-2-enoic acid;octadecyl 2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)O.CC=C(C)C(=O)OCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C23H44O2.C4H6O2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-23(24)22(3)5-2;1-3(2)4(5)6/h5H,4,6-21H2,1-3H3;1H2,2H3,(H,5,6) |
| InChIKey | BEXWRCOLZBPQQG-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|