C14H20O4 — CID 174733011
2-methyl-4-(2-methylpropoxycarbonyl)octa-2,4,6-trienoic acid (PubChem CID 174733011) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-methyl-4-(2-methylpropoxycarbonyl)octa-2,4,6-trienoic acid.
| Compound Name | 2-methyl-4-(2-methylpropoxycarbonyl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 174733011 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-methyl-4-(2-methylpropoxycarbonyl)octa-2,4,6-trienoic acid |
| SMILES | CC=CC=C(C=C(C)C(=O)O)C(=O)OCC(C)C |
| InChI | InChI=1S/C14H20O4/c1-5-6-7-12(8-11(4)13(15)16)14(17)18-9-10(2)3/h5-8,10H,9H2,1-4H3,(H,15,16) |
| InChIKey | SDJBMPZYZIJTHI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|