C14H28O7 — CID 159356669
2,2-bis(hydroxymethyl)propane-1,3-diol;methyl 2-methylprop-2-enoate;oxolane (PubChem CID 159356669) has the molecular formula C14H28O7 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;methyl 2-methylprop-2-enoate;oxolane.
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;methyl 2-methylprop-2-enoate;oxolane |
|---|---|
| PubChem CID | 159356669 |
| Molecular Formula | C14H28O7 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;methyl 2-methylprop-2-enoate;oxolane |
| SMILES | C1CCOC1.C=C(C)C(=O)OC.OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H12O4.C5H8O2.C4H8O/c6-1-5(2-7,3-8)4-9;1-4(2)5(6)7-3;1-2-4-5-3-1/h6-9H,1-4H2;1H2,2-3H3;1-4H2 |
| InChIKey | LHZXDTGUCCHXKT-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|