C9H20O4Si2 — CID 173224695
3-[ethoxy(silyloxy)silyl]propyl 2-methylprop-2-enoate (PubChem CID 173224695) has the molecular formula C9H20O4Si2 and a molecular weight of 248.43 g/mol. Its IUPAC name is 3-[ethoxy(silyloxy)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[ethoxy(silyloxy)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173224695 |
| Molecular Formula | C9H20O4Si2 |
| Molecular Weight | 248.43 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-[ethoxy(silyloxy)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH](O[SiH3])OCC |
| InChI | InChI=1S/C9H20O4Si2/c1-4-12-15(13-14)7-5-6-11-9(10)8(2)3/h15H,2,4-7H2,1,3,14H3 |
| InChIKey | SXLSYMPZWUSQQC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|