C17H34O5Si — CID 175326271
butyl 2-methylprop-2-enoate;ethoxysilane;propyl 2-methylprop-2-enoate (PubChem CID 175326271) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;ethoxysilane;propyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;ethoxysilane;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175326271 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | butyl 2-methylprop-2-enoate;ethoxysilane;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.C=C(C)C(=O)OCCCC.CCO[SiH3] |
| InChI | InChI=1S/C8H14O2.C7H12O2.C2H8OSi/c1-4-5-6-10-8(9)7(2)3;1-4-5-9-7(8)6(2)3;1-2-3-4/h2,4-6H2,1,3H3;2,4-5H2,1,3H3;2H2,1,4H3 |
| InChIKey | COMITCBXNBHCAT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|