C12H20O6 — CID 158017559
4-hydroxybutyl 2-methylprop-2-enoate;3-oxobutanoic acid (PubChem CID 158017559) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-hydroxybutyl 2-methylprop-2-enoate;3-oxobutanoic acid.
| Compound Name | 4-hydroxybutyl 2-methylprop-2-enoate;3-oxobutanoic acid |
|---|---|
| PubChem CID | 158017559 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-hydroxybutyl 2-methylprop-2-enoate;3-oxobutanoic acid |
| SMILES | C=C(C)C(=O)OCCCCO.CC(=O)CC(=O)O |
| InChI | InChI=1S/C8H14O3.C4H6O3/c1-7(2)8(10)11-6-4-3-5-9;1-3(5)2-4(6)7/h9H,1,3-6H2,2H3;2H2,1H3,(H,6,7) |
| InChIKey | FFQSXNJFDYTLQK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|