C25H52N4O5S — CID 59653295
1-amino-2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethanesulfonate;tetrabutylazanium (PubChem CID 59653295) has the molecular formula C25H52N4O5S and a molecular weight of 520.78 g/mol. Its IUPAC name is 1-amino-2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethanesulfonate;tetrabutylazanium.
| Compound Name | 1-amino-2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethanesulfonate;tetrabutylazanium |
|---|---|
| PubChem CID | 59653295 |
| Molecular Formula | C25H52N4O5S |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 1-amino-2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethanesulfonate;tetrabutylazanium |
| SMILES | C=C(C)C(=O)NCCCNC(=O)C(N)S(=O)(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C9H17N3O5S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6(2)8(13)11-4-3-5-12-9(14)7(10)18(15,16)17/h5-16H2,1-4H3;7H,1,3-5,10H2,2H3,(H,11,13)(H,12,14)(H,15,16,17)/q+1;/p-1 |
| InChIKey | PRELJAWCZFNKOP-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|