C10H17NO6 — CID 22858879
2-methyl-N-[(2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl]prop-2-enamide (PubChem CID 22858879) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-methyl-N-[(2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl]prop-2-enamide.
| Compound Name | 2-methyl-N-[(2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 22858879 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-methyl-N-[(2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)C=O |
| InChI | InChI=1S/C10H17NO6/c1-5(2)10(17)11-8(6(14)3-12)9(16)7(15)4-13/h3,6-9,13-16H,1,4H2,2H3,(H,11,17)/t6-,7+,8+,9+/m0/s1 |
| InChIKey | MSPPFNXVLRXDGO-JQCXWYLXSA-N |
| XLogP | -2.68 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|