C9H18N2O5S — CID 174949821
3-aminopropanoic acid;2-formamido-4-methylsulfanylbutanoic acid (PubChem CID 174949821) has the molecular formula C9H18N2O5S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3-aminopropanoic acid;2-formamido-4-methylsulfanylbutanoic acid.
| Compound Name | 3-aminopropanoic acid;2-formamido-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 174949821 |
| Molecular Formula | C9H18N2O5S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-aminopropanoic acid;2-formamido-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC=O)C(=O)O.NCCC(=O)O |
| InChI | InChI=1S/C6H11NO3S.C3H7NO2/c1-11-3-2-5(6(9)10)7-4-8;4-2-1-3(5)6/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10);1-2,4H2,(H,5,6) |
| InChIKey | FYHSOVJDHCZMPF-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|