C18H34N6O9S — CID 173093471
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis((2S)-2-aminopropanoic acid);(2S)-2-formamido-4-methylsulfanylbutanoic acid (PubChem CID 173093471) has the molecular formula C18H34N6O9S and a molecular weight of 510.57 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis((2S)-2-aminopropanoic acid);(2S)-2-formamido-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis((2S)-2-aminopropanoic acid);(2S)-2-formamido-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 173093471 |
| Molecular Formula | C18H34N6O9S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;bis((2S)-2-aminopropanoic acid);(2S)-2-formamido-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC=O)C(=O)O.C[C@H](N)C(=O)O.C[C@H](N)C(=O)O.N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2.C6H11NO3S.2C3H7NO2/c7-5(6(10)11)1-4-2-8-3-9-4;1-11-3-2-5(6(9)10)7-4-8;2*1-2(4)3(5)6/h2-3,5H,1,7H2,(H,8,9)(H,10,11);4-5H,2-3H2,1H3,(H,7,8)(H,9,10);2*2H,4H2,1H3,(H,5,6)/t2*5-;2*2-/m0000/s1 |
| InChIKey | CYYCGVXYSOPZSP-CYPVLMBRSA-N |
| XLogP | -1.86 |
| TPSA | 285.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|