C21H42N6O6 — CID 18306575
6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid (PubChem CID 18306575) has the molecular formula C21H42N6O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18306575 |
| Molecular Formula | C21H42N6O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H42N6O6/c1-13(2)11-16(26-18(29)14(24)7-3-5-9-22)19(30)27-17(12-28)20(31)25-15(21(32)33)8-4-6-10-23/h13-17,28H,3-12,22-24H2,1-2H3,(H,25,31)(H,26,29)(H,27,30)(H,32,33) |
| InChIKey | GYKBLRNAQJXVFU-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|