C15H28N6O6 — CID 22655091
2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 22655091) has the molecular formula C15H28N6O6 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22655091 |
| Molecular Formula | C15H28N6O6 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]acetyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)CNC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H28N6O6/c1-8(15(26)27)20-14(25)10(4-2-3-5-16)21-12(23)7-19-13(24)9(17)6-11(18)22/h8-10H,2-7,16-17H2,1H3,(H2,18,22)(H,19,24)(H,20,25)(H,21,23)(H,26,27) |
| InChIKey | BPLJFKJSELGMGA-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|