C15H28N6O7 — CID 18305140
2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18305140) has the molecular formula C15H28N6O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18305140 |
| Molecular Formula | C15H28N6O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCCCCC(N)C(=O)NCC(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C15H28N6O7/c16-4-2-1-3-8(17)13(25)19-6-12(24)20-9(5-11(18)23)14(26)21-10(7-22)15(27)28/h8-10,22H,1-7,16-17H2,(H2,18,23)(H,19,25)(H,20,24)(H,21,26)(H,27,28) |
| InChIKey | PAXDLCOBFBYZHP-UHFFFAOYSA-N |
| XLogP | -4.52 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|