C17H32N6O6S — CID 18305137
2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18305137) has the molecular formula C17H32N6O6S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18305137 |
| Molecular Formula | C17H32N6O6S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[[4-amino-2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-4-oxobutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CC(N)=O)NC(=O)CNC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C17H32N6O6S/c1-30-7-5-11(17(28)29)23-16(27)12(8-13(20)24)22-14(25)9-21-15(26)10(19)4-2-3-6-18/h10-12H,2-9,18-19H2,1H3,(H2,20,24)(H,21,26)(H,22,25)(H,23,27)(H,28,29) |
| InChIKey | DLXWTHZIXVRPSY-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|