C20H36N6O8 — CID 22656670
2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]butanedioic acid (PubChem CID 22656670) has the molecular formula C20H36N6O8 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22656670 |
| Molecular Formula | C20H36N6O8 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylpentanoyl]amino]butanedioic acid |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(N)CC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H36N6O8/c1-10(2)7-13(19(32)26-14(20(33)34)9-16(28)29)25-18(31)12(5-3-4-6-21)24-17(30)11(22)8-15(23)27/h10-14H,3-9,21-22H2,1-2H3,(H2,23,27)(H,24,30)(H,25,31)(H,26,32)(H,28,29)(H,33,34) |
| InChIKey | ROYNJMSUSRYNMR-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|