C27H45N5O5 — CID 18306459
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18306459) has the molecular formula C27H45N5O5 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18306459 |
| Molecular Formula | C27H45N5O5 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(C)C)NC(=O)C(N)CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H45N5O5/c1-5-18(4)23(26(35)31-22(27(36)37)16-19-11-7-6-8-12-19)32-25(34)21(15-17(2)3)30-24(33)20(29)13-9-10-14-28/h6-8,11-12,17-18,20-23H,5,9-10,13-16,28-29H2,1-4H3,(H,30,33)(H,31,35)(H,32,34)(H,36,37) |
| InChIKey | VHXVZXLBVMFCIQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|