C27H45N5O6 — CID 18309632
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid (PubChem CID 18309632) has the molecular formula C27H45N5O6 and a molecular weight of 535.69 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18309632 |
| Molecular Formula | C27H45N5O6 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCCN)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C27H45N5O6/c1-5-17(4)23(26(36)31-22(27(37)38)14-16(2)3)32-25(35)21(15-18-9-11-19(33)12-10-18)30-24(34)20(29)8-6-7-13-28/h9-12,16-17,20-23,33H,5-8,13-15,28-29H2,1-4H3,(H,30,34)(H,31,36)(H,32,35)(H,37,38) |
| InChIKey | AEPNVDINJAFSSL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|