C31H50N6O9 — CID 18350378
6-amino-2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid (PubChem CID 18350378) has the molecular formula C31H50N6O9 and a molecular weight of 650.77 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18350378 |
| Molecular Formula | C31H50N6O9 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-carboxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CC(=O)O)NC(=O)C(N)CC(C)C)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C31H50N6O9/c1-5-18(4)26(30(44)34-22(31(45)46)8-6-7-13-32)37-29(43)23(15-19-9-11-20(38)12-10-19)36-28(42)24(16-25(39)40)35-27(41)21(33)14-17(2)3/h9-12,17-18,21-24,26,38H,5-8,13-16,32-33H2,1-4H3,(H,34,44)(H,35,41)(H,36,42)(H,37,43)(H,39,40)(H,45,46) |
| InChIKey | NAYZHAXDZPJAEH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 263.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|