C19H37N5O6S — CID 18259202
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 18259202) has the molecular formula C19H37N5O6S and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18259202 |
| Molecular Formula | C19H37N5O6S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(CCCCN)NC(=O)C(N)CS)C(C)O)C(=O)O |
| InChI | InChI=1S/C19H37N5O6S/c1-4-10(2)14(19(29)30)23-18(28)15(11(3)25)24-17(27)13(7-5-6-8-20)22-16(26)12(21)9-31/h10-15,25,31H,4-9,20-21H2,1-3H3,(H,22,26)(H,23,28)(H,24,27)(H,29,30) |
| InChIKey | KIILXQCAPPVRGN-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|