C20H39N5O5S — CID 18259073
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid (PubChem CID 18259073) has the molecular formula C20H39N5O5S and a molecular weight of 461.63 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18259073 |
| Molecular Formula | C20H39N5O5S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C20H39N5O5S/c1-5-12(4)16(19(28)24-15(11(2)3)20(29)30)25-18(27)14(8-6-7-9-21)23-17(26)13(22)10-31/h11-16,31H,5-10,21-22H2,1-4H3,(H,23,26)(H,24,28)(H,25,27)(H,29,30) |
| InChIKey | GARUXAYKRPWDKE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|