C14H28N4O4S — CID 18219977
2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylbutanoic acid (PubChem CID 18219977) has the molecular formula C14H28N4O4S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18219977 |
| Molecular Formula | C14H28N4O4S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C14H28N4O4S/c1-8(2)11(14(21)22)18-13(20)10(5-3-4-6-15)17-12(19)9(16)7-23/h8-11,23H,3-7,15-16H2,1-2H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | ZXCAQANTQWBICD-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|