C30H55N7O10S — CID 21219825
6-amino-2-[[2-[[2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 21219825) has the molecular formula C30H55N7O10S and a molecular weight of 705.88 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 21219825 |
| Molecular Formula | C30H55N7O10S |
| Molecular Weight | 705.88 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CS)C(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O)C(C)O |
| InChI | InChI=1S/C30H55N7O10S/c1-6-16(4)23(36-25(41)18(32)14-48)28(44)37-24(17(5)38)29(45)35-21(13-15(2)3)27(43)33-19(10-11-22(39)40)26(42)34-20(30(46)47)9-7-8-12-31/h15-21,23-24,38,48H,6-14,31-32H2,1-5H3,(H,33,43)(H,34,42)(H,35,45)(H,36,41)(H,37,44)(H,39,40)(H,46,47) |
| InChIKey | GETNXOPZNIDXML-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 292.37 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.88 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|