C21H39N5O8 — CID 22699186
6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 22699186) has the molecular formula C21H39N5O8 and a molecular weight of 489.57 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22699186 |
| Molecular Formula | C21H39N5O8 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(N)CCC(=O)O)C(C)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H39N5O8/c1-11(2)10-15(19(31)24-14(21(33)34)6-4-5-9-22)25-20(32)17(12(3)27)26-18(30)13(23)7-8-16(28)29/h11-15,17,27H,4-10,22-23H2,1-3H3,(H,24,31)(H,25,32)(H,26,30)(H,28,29)(H,33,34) |
| InChIKey | PWWZASTWTHGGKB-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|