C18H35N5O7 — CID 18310175
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18310175) has the molecular formula C18H35N5O7 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18310175 |
| Molecular Formula | C18H35N5O7 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(C(=O)NC(CO)C(=O)O)C(C)O |
| InChI | InChI=1S/C18H35N5O7/c1-9(2)13(22-15(26)11(20)6-4-5-7-19)16(27)23-14(10(3)25)17(28)21-12(8-24)18(29)30/h9-14,24-25H,4-8,19-20H2,1-3H3,(H,21,28)(H,22,26)(H,23,27)(H,29,30) |
| InChIKey | XHIYJKJUOABNRU-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|