C20H36N6O8S — CID 22656712
2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid (PubChem CID 22656712) has the molecular formula C20H36N6O8S and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22656712 |
| Molecular Formula | C20H36N6O8S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]pentanedioic acid |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(N)CC(N)=O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H36N6O8S/c1-35-9-7-13(19(32)26-14(20(33)34)5-6-16(28)29)25-18(31)12(4-2-3-8-21)24-17(30)11(22)10-15(23)27/h11-14H,2-10,21-22H2,1H3,(H2,23,27)(H,24,30)(H,25,31)(H,26,32)(H,28,29)(H,33,34) |
| InChIKey | WOKWDMXCUMEGMB-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|