C20H35N5O9S — CID 18311664
2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 18311664) has the molecular formula C20H35N5O9S and a molecular weight of 521.59 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18311664 |
| Molecular Formula | C20H35N5O9S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-carboxypropanoyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | CSCCC(N)C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H35N5O9S/c1-35-9-7-11(22)17(30)25-14(10-16(28)29)19(32)23-12(4-2-3-8-21)18(31)24-13(20(33)34)5-6-15(26)27/h11-14H,2-10,21-22H2,1H3,(H,23,32)(H,24,31)(H,25,30)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | TYTUEDYURDPIGG-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|