C19H35N5O7S — CID 18310351
6-amino-2-[[2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18310351) has the molecular formula C19H35N5O7S and a molecular weight of 477.58 g/mol. Its IUPAC name is 6-amino-2-[[2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18310351 |
| Molecular Formula | C19H35N5O7S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 6-amino-2-[[2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CSCCC(N)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H35N5O7S/c1-11(22-17(28)12(21)8-10-32-2)16(27)23-13(6-7-15(25)26)18(29)24-14(19(30)31)5-3-4-9-20/h11-14H,3-10,20-21H2,1-2H3,(H,22,28)(H,23,27)(H,24,29)(H,25,26)(H,30,31) |
| InChIKey | LGKRXFSKYLXNDZ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|