C13H23N3O6S — CID 18222677
2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]pentanedioic acid (PubChem CID 18222677) has the molecular formula C13H23N3O6S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18222677 |
| Molecular Formula | C13H23N3O6S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[2-[(2-amino-4-methylsulfanylbutanoyl)amino]propanoylamino]pentanedioic acid |
| SMILES | CSCCC(N)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23N3O6S/c1-7(15-12(20)8(14)5-6-23-2)11(19)16-9(13(21)22)3-4-10(17)18/h7-9H,3-6,14H2,1-2H3,(H,15,20)(H,16,19)(H,17,18)(H,21,22) |
| InChIKey | ONGCSGVHCSAATF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |