C15H29N5O5S — CID 18219216
6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid (PubChem CID 18219216) has the molecular formula C15H29N5O5S and a molecular weight of 391.49 g/mol. Its IUPAC name is 6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18219216 |
| Molecular Formula | C15H29N5O5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C15H29N5O5S/c1-26-7-5-10(19-13(22)9(17)8-12(18)21)14(23)20-11(15(24)25)4-2-3-6-16/h9-11H,2-8,16-17H2,1H3,(H2,18,21)(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | QGABLMITFKUQDF-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|