C17H29N7O5 — CID 18495437
6-amino-2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]propanoylamino]hexanoic acid (PubChem CID 18495437) has the molecular formula C17H29N7O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 6-amino-2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18495437 |
| Molecular Formula | C17H29N7O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 6-amino-2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)CNC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C17H29N7O5/c1-10(15(26)24-13(17(28)29)4-2-3-5-18)23-14(25)8-21-16(27)12(19)6-11-7-20-9-22-11/h7,9-10,12-13H,2-6,8,18-19H2,1H3,(H,20,22)(H,21,27)(H,23,25)(H,24,26)(H,28,29) |
| InChIKey | ZPTHCJKJYRSNOA-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|