C24H38N8O6S — CID 22657297
2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22657297) has the molecular formula C24H38N8O6S and a molecular weight of 566.69 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22657297 |
| Molecular Formula | C24H38N8O6S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]pentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H38N8O6S/c1-39-11-9-17(23(37)38)31-21(35)16(8-5-10-29-24(27)28)30-22(36)18(12-14-6-3-2-4-7-14)32-20(34)15(25)13-19(26)33/h2-4,6-7,15-18H,5,8-13,25H2,1H3,(H2,26,33)(H,30,36)(H,31,35)(H,32,34)(H,37,38)(H4,27,28,29) |
| InChIKey | NNCGEZKPPQHOQU-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|