C29H41N7O6S — CID 18246047
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18246047) has the molecular formula C29H41N7O6S and a molecular weight of 615.76 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18246047 |
| Molecular Formula | C29H41N7O6S |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C29H41N7O6S/c1-43-15-13-22(28(41)42)34-26(39)24(17-19-9-11-20(37)12-10-19)36-27(40)23(16-18-6-3-2-4-7-18)35-25(38)21(30)8-5-14-33-29(31)32/h2-4,6-7,9-12,21-24,37H,5,8,13-17,30H2,1H3,(H,34,39)(H,35,38)(H,36,40)(H,41,42)(H4,31,32,33) |
| InChIKey | BMKDCKUZHLRPED-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|