C10H19N3O6S — CID 18224466
2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18224466) has the molecular formula C10H19N3O6S and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18224466 |
| Molecular Formula | C10H19N3O6S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CO)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C10H19N3O6S/c1-4(15)7(11)9(17)12-5(2-14)8(16)13-6(3-20)10(18)19/h4-7,14-15,20H,2-3,11H2,1H3,(H,12,17)(H,13,16)(H,18,19) |
| InChIKey | NBIIPOKZPUGATB-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|