C16H30N6O6 — CID 18232804
4-amino-2-[[6-amino-2-[2-(2-aminopropanoylamino)propanoylamino]hexanoyl]amino]-4-oxobutanoic acid (PubChem CID 18232804) has the molecular formula C16H30N6O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-amino-2-[[6-amino-2-[2-(2-aminopropanoylamino)propanoylamino]hexanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[6-amino-2-[2-(2-aminopropanoylamino)propanoylamino]hexanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18232804 |
| Molecular Formula | C16H30N6O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-amino-2-[[6-amino-2-[2-(2-aminopropanoylamino)propanoylamino]hexanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(N)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H30N6O6/c1-8(18)13(24)20-9(2)14(25)21-10(5-3-4-6-17)15(26)22-11(16(27)28)7-12(19)23/h8-11H,3-7,17-18H2,1-2H3,(H2,19,23)(H,20,24)(H,21,25)(H,22,26)(H,27,28) |
| InChIKey | KUHRIMLUOKIPRW-UHFFFAOYSA-N |
| XLogP | -3.10 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|