C17H28N4O10S — CID 18264372
2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 18264372) has the molecular formula C17H28N4O10S and a molecular weight of 480.50 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18264372 |
| Molecular Formula | C17H28N4O10S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(NC(=O)C(CS)NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H28N4O10S/c1-7(22)13(16(29)19-9(17(30)31)3-5-12(25)26)21-15(28)10(6-32)20-14(27)8(18)2-4-11(23)24/h7-10,13,22,32H,2-6,18H2,1H3,(H,19,29)(H,20,27)(H,21,28)(H,23,24)(H,25,26)(H,30,31) |
| InChIKey | JPFNSQRHBZRWDO-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 245.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|