C20H39N5O5 — CID 18302710
2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylbutanoyl]amino]-4-methylpentanoic acid (PubChem CID 18302710) has the molecular formula C20H39N5O5 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylbutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylbutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18302710 |
| Molecular Formula | C20H39N5O5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylbutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(C)NC(=O)C(N)CCCCN)C(C)C)C(=O)O |
| InChI | InChI=1S/C20H39N5O5/c1-11(2)10-15(20(29)30)24-19(28)16(12(3)4)25-17(26)13(5)23-18(27)14(22)8-6-7-9-21/h11-16H,6-10,21-22H2,1-5H3,(H,23,27)(H,24,28)(H,25,26)(H,29,30) |
| InChIKey | XFDONHOZGWHYCJ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|