C23H35N5O8 — CID 18307754
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 18307754) has the molecular formula C23H35N5O8 and a molecular weight of 509.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18307754 |
| Molecular Formula | C23H35N5O8 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H35N5O8/c24-11-5-4-8-15(25)20(32)27-17(12-14-6-2-1-3-7-14)21(33)28-18(13-29)22(34)26-16(23(35)36)9-10-19(30)31/h1-3,6-7,15-18,29H,4-5,8-13,24-25H2,(H,26,34)(H,27,32)(H,28,33)(H,30,31)(H,35,36) |
| InChIKey | LABDUBKFBRAZHU-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|