C17H25N3O5 — CID 57134683
(3S)-3-amino-2-benzyl-4-[(2S)-2,6-diaminohexanoyl]oxy-4-oxobutanoic acid (PubChem CID 57134683) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is (3S)-3-amino-2-benzyl-4-[(2S)-2,6-diaminohexanoyl]oxy-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-2-benzyl-4-[(2S)-2,6-diaminohexanoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57134683 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (3S)-3-amino-2-benzyl-4-[(2S)-2,6-diaminohexanoyl]oxy-4-oxobutanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)OC(=O)[C@@H](N)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25N3O5/c18-9-5-4-8-13(19)16(23)25-17(24)14(20)12(15(21)22)10-11-6-2-1-3-7-11/h1-3,6-7,12-14H,4-5,8-10,18-20H2,(H,21,22)/t12?,13-,14-/m0/s1 |
| InChIKey | PZCSFGVTFTYCEG-TTZKSVMKSA-N |
| XLogP | -0.22 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|