C14H22N4O3 — CID 57072331
[(2S)-2-amino-3-(4-aminophenyl)propanoyl] (2R)-2,5-diaminopentanoate (PubChem CID 57072331) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is [(2S)-2-amino-3-(4-aminophenyl)propanoyl] (2R)-2,5-diaminopentanoate.
| Compound Name | [(2S)-2-amino-3-(4-aminophenyl)propanoyl] (2R)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 57072331 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [(2S)-2-amino-3-(4-aminophenyl)propanoyl] (2R)-2,5-diaminopentanoate |
| SMILES | NCCC[C@@H](N)C(=O)OC(=O)[C@@H](N)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C14H22N4O3/c15-7-1-2-11(17)13(19)21-14(20)12(18)8-9-3-5-10(16)6-4-9/h3-6,11-12H,1-2,7-8,15-18H2/t11-,12+/m1/s1 |
| InChIKey | LOFNBNYHEMNPHF-NEPJUHHUSA-N |
| XLogP | -0.73 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|