C15H23N3O4 — CID 87525392
[(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl] (2S)-2,5-diaminopentanoate (PubChem CID 87525392) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is [(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl] (2S)-2,5-diaminopentanoate.
| Compound Name | [(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl] (2S)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 87525392 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoyl] (2S)-2,5-diaminopentanoate |
| SMILES | CN[C@@H](Cc1ccc(O)cc1)C(=O)OC(=O)[C@@H](N)CCCN |
| InChI | InChI=1S/C15H23N3O4/c1-18-13(9-10-4-6-11(19)7-5-10)15(21)22-14(20)12(17)3-2-8-16/h4-7,12-13,18-19H,2-3,8-9,16-17H2,1H3/t12-,13-/m0/s1 |
| InChIKey | FYDHTLCOQJTNIG-STQMWFEESA-N |
| XLogP | -0.34 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|