C14H19ClN2O4S — CID 90750282
[(2S)-2-amino-3-(4-chlorophenyl)propanoyl] (2S)-2-amino-4-methylsulfinylbutanoate (PubChem CID 90750282) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is [(2S)-2-amino-3-(4-chlorophenyl)propanoyl] (2S)-2-amino-4-methylsulfinylbutanoate.
| Compound Name | [(2S)-2-amino-3-(4-chlorophenyl)propanoyl] (2S)-2-amino-4-methylsulfinylbutanoate |
|---|---|
| PubChem CID | 90750282 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(2S)-2-amino-3-(4-chlorophenyl)propanoyl] (2S)-2-amino-4-methylsulfinylbutanoate |
| SMILES | CS(=O)CC[C@H](N)C(=O)OC(=O)[C@@H](N)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O4S/c1-22(20)7-6-11(16)13(18)21-14(19)12(17)8-9-2-4-10(15)5-3-9/h2-5,11-12H,6-8,16-17H2,1H3/t11-,12-,22?/m0/s1 |
| InChIKey | DPGFQBSVCFIVMT-OXWGMBQASA-N |
| XLogP | 0.38 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|