C24H28N2O3S2 — CID 90936040
[(2S)-2-amino-3-(4-propanethioylphenyl)propanoyl] (2S)-2-amino-3-(4-propanethioylphenyl)propanoate (PubChem CID 90936040) has the molecular formula C24H28N2O3S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is [(2S)-2-amino-3-(4-propanethioylphenyl)propanoyl] (2S)-2-amino-3-(4-propanethioylphenyl)propanoate.
| Compound Name | [(2S)-2-amino-3-(4-propanethioylphenyl)propanoyl] (2S)-2-amino-3-(4-propanethioylphenyl)propanoate |
|---|---|
| PubChem CID | 90936040 |
| Molecular Formula | C24H28N2O3S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(2S)-2-amino-3-(4-propanethioylphenyl)propanoyl] (2S)-2-amino-3-(4-propanethioylphenyl)propanoate |
| SMILES | CCC(=S)c1ccc(C[C@H](N)C(=O)OC(=O)[C@@H](N)Cc2ccc(C(=S)CC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O3S2/c1-3-21(30)17-9-5-15(6-10-17)13-19(25)23(27)29-24(28)20(26)14-16-7-11-18(12-8-16)22(31)4-2/h5-12,19-20H,3-4,13-14,25-26H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | BVSNTTBZSMKYGI-PMACEKPBSA-N |
| XLogP | 3.45 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|