C13H15NO8 — CID 174408149
4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 174408149) has the molecular formula C13H15NO8 and a molecular weight of 313.26 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174408149 |
| Molecular Formula | C13H15NO8 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)OC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C13H15NO8/c14-8(5-6-1-3-7(15)4-2-6)12(20)22-13(21)10(17)9(16)11(18)19/h1-4,8-10,15-17H,5,14H2,(H,18,19)/t8-,9?,10?/m0/s1 |
| InChIKey | WRVUBCDCUZXCIA-IDKOKCKLSA-N |
| XLogP | -1.86 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|