C24H45NO4 — CID 14728425
(2S)-2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]-4-methylpentanoic acid (PubChem CID 14728425) has the molecular formula C24H45NO4 and a molecular weight of 411.63 g/mol. Its IUPAC name is (2S)-2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 14728425 |
| Molecular Formula | C24H45NO4 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | (2S)-2-[[(Z,12R)-12-hydroxyoctadec-9-enoyl]amino]-4-methylpentanoic acid |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C24H45NO4/c1-4-5-6-13-16-21(26)17-14-11-9-7-8-10-12-15-18-23(27)25-22(24(28)29)19-20(2)3/h11,14,20-22,26H,4-10,12-13,15-19H2,1-3H3,(H,25,27)(H,28,29)/b14-11-/t21-,22+/m1/s1 |
| InChIKey | LFYBIWUNIDWTTJ-JNNLJUPQSA-N |
| XLogP | 5.61 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|