C23H45N2O4+ — CID 123180158
[carboxy-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]methyl]-trimethylazanium (PubChem CID 123180158) has the molecular formula C23H45N2O4+ and a molecular weight of 413.62 g/mol. Its IUPAC name is [carboxy-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]methyl]-trimethylazanium.
| Compound Name | [carboxy-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]methyl]-trimethylazanium |
|---|---|
| PubChem CID | 123180158 |
| Molecular Formula | C23H45N2O4+ |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.34 |
| IUPAC Name | [carboxy-[[(12R)-12-hydroxyoctadec-9-enoyl]amino]methyl]-trimethylazanium |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)NC(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C23H44N2O4/c1-5-6-7-14-17-20(26)18-15-12-10-8-9-11-13-16-19-21(27)24-22(23(28)29)25(2,3)4/h12,15,20,22,26H,5-11,13-14,16-19H2,1-4H3,(H-,24,27,28,29)/p+1/t20-,22?/m1/s1 |
| InChIKey | BIULBBUTYQPIEH-PSDZMVHGSA-O |
| XLogP | 4.23 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|