C19H26N2O5S — CID 15364844
methyl (2R)-3-[(E)-3-(butylamino)-3-oxoprop-1-enyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 15364844) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is methyl (2R)-3-[(E)-3-(butylamino)-3-oxoprop-1-enyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2R)-3-[(E)-3-(butylamino)-3-oxoprop-1-enyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 15364844 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | methyl (2R)-3-[(E)-3-(butylamino)-3-oxoprop-1-enyl]sulfanyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCCCNC(=O)/C=C/SC[C@H](NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H26N2O5S/c1-3-4-11-20-17(22)10-12-27-14-16(18(23)25-2)21-19(24)26-13-15-8-6-5-7-9-15/h5-10,12,16H,3-4,11,13-14H2,1-2H3,(H,20,22)(H,21,24)/b12-10+/t16-/m0/s1 |
| InChIKey | JKFCIWACUHKIFW-TYZQSYOASA-N |
| XLogP | 2.62 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|