C19H29NO5S — CID 101477331
methyl (2S)-4-hexylsulfinyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 101477331) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is methyl (2S)-4-hexylsulfinyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S)-4-hexylsulfinyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 101477331 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | methyl (2S)-4-hexylsulfinyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCCCCCS(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H29NO5S/c1-3-4-5-9-13-26(23)14-12-17(18(21)24-2)20-19(22)25-15-16-10-7-6-8-11-16/h6-8,10-11,17H,3-5,9,12-15H2,1-2H3,(H,20,22)/t17-,26?/m0/s1 |
| InChIKey | OMIIQMPYFAZSES-WFFHQLTOSA-N |
| XLogP | 3.17 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|